C29H42F6O — CID 20750903
1-ethoxy-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-2,3-bis(trifluoromethyl)benzene (PubChem CID 20750903) has the molecular formula C29H42F6O and a molecular weight of 520.64 g/mol. Its IUPAC name is 1-ethoxy-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 1-ethoxy-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20750903 |
| Molecular Formula | C29H42F6O |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 1-ethoxy-4-[2-[4-(4-pentylcyclohexyl)cyclohexyl]ethyl]-2,3-bis(trifluoromethyl)benzene |
| SMILES | CCCCCC1CCC(C2CCC(CCc3ccc(OCC)c(C(F)(F)F)c3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C29H42F6O/c1-3-5-6-7-20-8-13-22(14-9-20)23-15-10-21(11-16-23)12-17-24-18-19-25(36-4-2)27(29(33,34)35)26(24)28(30,31)32/h18-23H,3-17H2,1-2H3 |
| InChIKey | XLDOSGOMFHDXBM-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|