C22H30F6 — CID 20750880
1-(4-pentylcyclohexyl)-4-propyl-2,3-bis(trifluoromethyl)benzene (PubChem CID 20750880) has the molecular formula C22H30F6 and a molecular weight of 408.47 g/mol. Its IUPAC name is 1-(4-pentylcyclohexyl)-4-propyl-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 1-(4-pentylcyclohexyl)-4-propyl-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 20750880 |
| Molecular Formula | C22H30F6 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-(4-pentylcyclohexyl)-4-propyl-2,3-bis(trifluoromethyl)benzene |
| SMILES | CCCCCC1CCC(c2ccc(CCC)c(C(F)(F)F)c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H30F6/c1-3-5-6-8-15-9-11-16(12-10-15)18-14-13-17(7-4-2)19(21(23,24)25)20(18)22(26,27)28/h13-16H,3-12H2,1-2H3 |
| InChIKey | QBKGWGHOKJZYLL-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|