C36H53F3O — CID 122502348
1-[difluoro-[4-[(E)-2-[4-[2-[4-[(E)-hept-5-enyl]cyclohexyl]ethyl]cyclohexyl]ethenyl]cyclohexyl]methoxy]-3-fluorobenzene (PubChem CID 122502348) has the molecular formula C36H53F3O and a molecular weight of 558.81 g/mol. Its IUPAC name is 1-[difluoro-[4-[(E)-2-[4-[2-[4-[(E)-hept-5-enyl]cyclohexyl]ethyl]cyclohexyl]ethenyl]cyclohexyl]methoxy]-3-fluorobenzene.
| Compound Name | 1-[difluoro-[4-[(E)-2-[4-[2-[4-[(E)-hept-5-enyl]cyclohexyl]ethyl]cyclohexyl]ethenyl]cyclohexyl]methoxy]-3-fluorobenzene |
|---|---|
| PubChem CID | 122502348 |
| Molecular Formula | C36H53F3O |
| Molecular Weight | 558.81 g/mol |
| Exact Mass | 558.40 |
| IUPAC Name | 1-[difluoro-[4-[(E)-2-[4-[2-[4-[(E)-hept-5-enyl]cyclohexyl]ethyl]cyclohexyl]ethenyl]cyclohexyl]methoxy]-3-fluorobenzene |
| SMILES | C/C=C/CCCCC1CCC(CCC2CCC(/C=C/C3CCC(C(F)(F)Oc4cccc(F)c4)CC3)CC2)CC1 |
| InChI | InChI=1S/C36H53F3O/c1-2-3-4-5-6-8-28-11-13-29(14-12-28)15-16-30-17-19-31(20-18-30)21-22-32-23-25-33(26-24-32)36(38,39)40-35-10-7-9-34(37)27-35/h2-3,7,9-10,21-22,27-33H,4-6,8,11-20,23-26H2,1H3/b3-2+,22-21+ |
| InChIKey | SUIKJGHAVAKQDI-PFGYVFLGSA-N |
| XLogP | 11.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.81 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|