C26H32F6O2 — CID 123290096
4-[difluoro-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]methoxy]-2-fluoro-1-(1,2,2-trifluoroethenoxy)benzene (PubChem CID 123290096) has the molecular formula C26H32F6O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 4-[difluoro-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]methoxy]-2-fluoro-1-(1,2,2-trifluoroethenoxy)benzene.
| Compound Name | 4-[difluoro-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]methoxy]-2-fluoro-1-(1,2,2-trifluoroethenoxy)benzene |
|---|---|
| PubChem CID | 123290096 |
| Molecular Formula | C26H32F6O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 4-[difluoro-[4-(4-pent-3-enylcyclohexyl)cyclohexyl]methoxy]-2-fluoro-1-(1,2,2-trifluoroethenoxy)benzene |
| SMILES | CC=CCCC1CCC(C2CCC(C(F)(F)Oc3ccc(OC(F)=C(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H32F6O2/c1-2-3-4-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)26(31,32)34-21-14-15-23(22(27)16-21)33-25(30)24(28)29/h2-3,14-20H,4-13H2,1H3 |
| InChIKey | ILRZZHLIFJWPBD-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|