C27H36F4O3 — CID 122577214
5-but-3-enyl-2-[4-[4-[(3,4-difluorophenoxy)-difluoromethyl]cyclohexyl]cyclohexyl]-1,3-dioxane (PubChem CID 122577214) has the molecular formula C27H36F4O3 and a molecular weight of 484.57 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-[(3,4-difluorophenoxy)-difluoromethyl]cyclohexyl]cyclohexyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[4-[4-[(3,4-difluorophenoxy)-difluoromethyl]cyclohexyl]cyclohexyl]-1,3-dioxane |
|---|---|
| PubChem CID | 122577214 |
| Molecular Formula | C27H36F4O3 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-[(3,4-difluorophenoxy)-difluoromethyl]cyclohexyl]cyclohexyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(C2CCC(C3CCC(C(F)(F)Oc4ccc(F)c(F)c4)CC3)CC2)OC1 |
| InChI | InChI=1S/C27H36F4O3/c1-2-3-4-18-16-32-26(33-17-18)21-7-5-19(6-8-21)20-9-11-22(12-10-20)27(30,31)34-23-13-14-24(28)25(29)15-23/h2,13-15,18-22,26H,1,3-12,16-17H2 |
| InChIKey | YFZUENBQJRJMRK-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|