C29H32F4O — CID 122578196
4-[4-[[4-(4-but-3-enylcyclohex-3-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2-difluorobenzene (PubChem CID 122578196) has the molecular formula C29H32F4O and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-[4-[[4-(4-but-3-enylcyclohex-3-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2-difluorobenzene.
| Compound Name | 4-[4-[[4-(4-but-3-enylcyclohex-3-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 122578196 |
| Molecular Formula | C29H32F4O |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 4-[4-[[4-(4-but-3-enylcyclohex-3-en-1-yl)cyclohexyl]-difluoromethoxy]phenyl]-1,2-difluorobenzene |
| SMILES | C=CCCC1=CCC(C2CCC(C(F)(F)Oc3ccc(-c4ccc(F)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C29H32F4O/c1-2-3-4-20-5-7-21(8-6-20)22-9-14-25(15-10-22)29(32,33)34-26-16-11-23(12-17-26)24-13-18-27(30)28(31)19-24/h2,5,11-13,16-19,21-22,25H,1,3-4,6-10,14-15H2 |
| InChIKey | KLFCKXIGJAVVFX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|