C25H31F7O2 — CID 122578041
5-[difluoro-[4-(4-pentylcyclohex-3-en-1-yl)cyclohexyl]methoxy]-1,3-difluoro-2-(trifluoromethoxy)benzene (PubChem CID 122578041) has the molecular formula C25H31F7O2 and a molecular weight of 496.51 g/mol. Its IUPAC name is 5-[difluoro-[4-(4-pentylcyclohex-3-en-1-yl)cyclohexyl]methoxy]-1,3-difluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 5-[difluoro-[4-(4-pentylcyclohex-3-en-1-yl)cyclohexyl]methoxy]-1,3-difluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 122578041 |
| Molecular Formula | C25H31F7O2 |
| Molecular Weight | 496.51 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 5-[difluoro-[4-(4-pentylcyclohex-3-en-1-yl)cyclohexyl]methoxy]-1,3-difluoro-2-(trifluoromethoxy)benzene |
| SMILES | CCCCCC1=CCC(C2CCC(C(F)(F)Oc3cc(F)c(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H31F7O2/c1-2-3-4-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)24(28,29)33-20-14-21(26)23(22(27)15-20)34-25(30,31)32/h6,14-15,17-19H,2-5,7-13H2,1H3 |
| InChIKey | KLXLEMYDNANWGK-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.51 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|