C34H39F9O2 — CID 122502186
2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-hexylbenzene (PubChem CID 122502186) has the molecular formula C34H39F9O2 and a molecular weight of 650.67 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-hexylbenzene.
| Compound Name | 2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-hexylbenzene |
|---|---|
| PubChem CID | 122502186 |
| Molecular Formula | C34H39F9O2 |
| Molecular Weight | 650.67 g/mol |
| Exact Mass | 650.28 |
| IUPAC Name | 2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-hexylbenzene |
| SMILES | CCCCCCc1cc(F)c(C2CCC(/C=C/C3CCC(C(F)(F)Oc4cc(F)c(OC(F)(F)F)c(F)c4)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C34H39F9O2/c1-2-3-4-5-6-23-17-27(35)31(28(36)18-23)24-13-9-21(10-14-24)7-8-22-11-15-25(16-12-22)33(39,40)44-26-19-29(37)32(30(38)20-26)45-34(41,42)43/h7-8,17-22,24-25H,2-6,9-16H2,1H3/b8-7+ |
| InChIKey | JZBFODXNMUAINM-BQYQJAHWSA-N |
| XLogP | 11.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.67 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|