C33H37F9O2 — CID 122502096
2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-pentylbenzene (PubChem CID 122502096) has the molecular formula C33H37F9O2 and a molecular weight of 636.64 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-pentylbenzene.
| Compound Name | 2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-pentylbenzene |
|---|---|
| PubChem CID | 122502096 |
| Molecular Formula | C33H37F9O2 |
| Molecular Weight | 636.64 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | 2-[4-[(E)-2-[4-[[3,5-difluoro-4-(trifluoromethoxy)phenoxy]-difluoromethyl]cyclohexyl]ethenyl]cyclohexyl]-1,3-difluoro-5-pentylbenzene |
| SMILES | CCCCCc1cc(F)c(C2CCC(/C=C/C3CCC(C(F)(F)Oc4cc(F)c(OC(F)(F)F)c(F)c4)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C33H37F9O2/c1-2-3-4-5-22-16-26(34)30(27(35)17-22)23-12-8-20(9-13-23)6-7-21-10-14-24(15-11-21)32(38,39)43-25-18-28(36)31(29(37)19-25)44-33(40,41)42/h6-7,16-21,23-24H,2-5,8-15H2,1H3/b7-6+ |
| InChIKey | XLZMEUAFCBYVJC-VOTSOKGWSA-N |
| XLogP | 11.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.64 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|