C32H45F3O — CID 122502151
1-[difluoro-[4-[(E)-2-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-4-fluorobenzene (PubChem CID 122502151) has the molecular formula C32H45F3O and a molecular weight of 502.71 g/mol. Its IUPAC name is 1-[difluoro-[4-[(E)-2-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-4-fluorobenzene.
| Compound Name | 1-[difluoro-[4-[(E)-2-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-4-fluorobenzene |
|---|---|
| PubChem CID | 122502151 |
| Molecular Formula | C32H45F3O |
| Molecular Weight | 502.71 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | 1-[difluoro-[4-[(E)-2-[4-(4-pent-4-enylcyclohexyl)cyclohexyl]ethenyl]cyclohexyl]methoxy]-4-fluorobenzene |
| SMILES | C=CCCCC1CCC(C2CCC(/C=C/C3CCC(C(F)(F)Oc4ccc(F)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C32H45F3O/c1-2-3-4-5-24-8-14-27(15-9-24)28-16-10-25(11-17-28)6-7-26-12-18-29(19-13-26)32(34,35)36-31-22-20-30(33)21-23-31/h2,6-7,20-29H,1,3-5,8-19H2/b7-6+ |
| InChIKey | MPKDTUGBKUNOAG-VOTSOKGWSA-N |
| XLogP | 10.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.71 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|