C29H35F3O — CID 122502038
1-[4-[(E)-2-[4-[difluoro-(4-fluorophenoxy)methyl]cyclohexyl]ethenyl]cyclohexyl]-4-ethylbenzene (PubChem CID 122502038) has the molecular formula C29H35F3O and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-[4-[(E)-2-[4-[difluoro-(4-fluorophenoxy)methyl]cyclohexyl]ethenyl]cyclohexyl]-4-ethylbenzene.
| Compound Name | 1-[4-[(E)-2-[4-[difluoro-(4-fluorophenoxy)methyl]cyclohexyl]ethenyl]cyclohexyl]-4-ethylbenzene |
|---|---|
| PubChem CID | 122502038 |
| Molecular Formula | C29H35F3O |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.26 |
| IUPAC Name | 1-[4-[(E)-2-[4-[difluoro-(4-fluorophenoxy)methyl]cyclohexyl]ethenyl]cyclohexyl]-4-ethylbenzene |
| SMILES | CCc1ccc(C2CCC(/C=C/C3CCC(C(F)(F)Oc4ccc(F)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H35F3O/c1-2-21-5-11-24(12-6-21)25-13-7-22(8-14-25)3-4-23-9-15-26(16-10-23)29(31,32)33-28-19-17-27(30)18-20-28/h3-6,11-12,17-20,22-23,25-26H,2,7-10,13-16H2,1H3/b4-3+ |
| InChIKey | AIMVHSMTGFTNIV-ONEGZZNKSA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|