C18H23F — CID 54500656
1-fluoro-4-(4-hexa-1,3-dienylcyclohexyl)benzene (PubChem CID 54500656) has the molecular formula C18H23F and a molecular weight of 258.38 g/mol. Its IUPAC name is 1-fluoro-4-(4-hexa-1,3-dienylcyclohexyl)benzene.
| Compound Name | 1-fluoro-4-(4-hexa-1,3-dienylcyclohexyl)benzene |
|---|---|
| PubChem CID | 54500656 |
| Molecular Formula | C18H23F |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 1-fluoro-4-(4-hexa-1,3-dienylcyclohexyl)benzene |
| SMILES | CCC=CC=CC1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H23F/c1-2-3-4-5-6-15-7-9-16(10-8-15)17-11-13-18(19)14-12-17/h3-6,11-16H,2,7-10H2,1H3 |
| InChIKey | YCEGXRAIBAPNJO-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|