C18H21F3 — CID 19967704
1,2,3-trifluoro-5-[4-[(1E,3E)-hexa-1,3-dienyl]cyclohexyl]benzene (PubChem CID 19967704) has the molecular formula C18H21F3 and a molecular weight of 294.36 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[4-[(1E,3E)-hexa-1,3-dienyl]cyclohexyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[4-[(1E,3E)-hexa-1,3-dienyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 19967704 |
| Molecular Formula | C18H21F3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1,2,3-trifluoro-5-[4-[(1E,3E)-hexa-1,3-dienyl]cyclohexyl]benzene |
| SMILES | CC/C=C/C=C/C1CCC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C18H21F3/c1-2-3-4-5-6-13-7-9-14(10-8-13)15-11-16(19)18(21)17(20)12-15/h3-6,11-14H,2,7-10H2,1H3/b4-3+,6-5+ |
| InChIKey | RUSJFAGHKCNEJX-VNKDHWASSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|