C24H29F3 — CID 18657424
5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]-1,2,3-trifluorobenzene (PubChem CID 18657424) has the molecular formula C24H29F3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 18657424 |
| Molecular Formula | C24H29F3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 5-[4-[(E)-4-(4-ethylcyclohexyl)but-3-en-1-ynyl]cyclohexyl]-1,2,3-trifluorobenzene |
| SMILES | CCC1CCC(/C=C/C#CC2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H29F3/c1-2-17-7-9-18(10-8-17)5-3-4-6-19-11-13-20(14-12-19)21-15-22(25)24(27)23(26)16-21/h3,5,15-20H,2,7-14H2,1H3/b5-3+ |
| InChIKey | WUBPKLNSSDABIA-HWKANZROSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|