C17H19F3O2 — CID 86708829
ethyl (E)-3-[4-(3,4,5-trifluorophenyl)cyclohexyl]prop-2-enoate (PubChem CID 86708829) has the molecular formula C17H19F3O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is ethyl (E)-3-[4-(3,4,5-trifluorophenyl)cyclohexyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(3,4,5-trifluorophenyl)cyclohexyl]prop-2-enoate |
|---|---|
| PubChem CID | 86708829 |
| Molecular Formula | C17H19F3O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | ethyl (E)-3-[4-(3,4,5-trifluorophenyl)cyclohexyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1CCC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C17H19F3O2/c1-2-22-16(21)8-5-11-3-6-12(7-4-11)13-9-14(18)17(20)15(19)10-13/h5,8-12H,2-4,6-7H2,1H3/b8-5+ |
| InChIKey | BBYCMOWTHPWXKI-VMPITWQZSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|