C17H17F3N2O6 — CID 91213985
2-(3-ethoxy-3-oxoprop-1-enyl)-6-(3,4,5-trifluorophenyl)piperazine-1,4-dicarboxylic acid (PubChem CID 91213985) has the molecular formula C17H17F3N2O6 and a molecular weight of 402.33 g/mol. Its IUPAC name is 2-(3-ethoxy-3-oxoprop-1-enyl)-6-(3,4,5-trifluorophenyl)piperazine-1,4-dicarboxylic acid.
| Compound Name | 2-(3-ethoxy-3-oxoprop-1-enyl)-6-(3,4,5-trifluorophenyl)piperazine-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 91213985 |
| Molecular Formula | C17H17F3N2O6 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-(3-ethoxy-3-oxoprop-1-enyl)-6-(3,4,5-trifluorophenyl)piperazine-1,4-dicarboxylic acid |
| SMILES | CCOC(=O)C=CC1CN(C(=O)O)CC(c2cc(F)c(F)c(F)c2)N1C(=O)O |
| InChI | InChI=1S/C17H17F3N2O6/c1-2-28-14(23)4-3-10-7-21(16(24)25)8-13(22(10)17(26)27)9-5-11(18)15(20)12(19)6-9/h3-6,10,13H,2,7-8H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | HIYVSCFHDYGULK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|