C16H20F2N2O6 — CID 2846018
ethyl 4-[(2,4-difluorophenyl)methyl]piperazine-1-carboxylate;oxalic acid (PubChem CID 2846018) has the molecular formula C16H20F2N2O6 and a molecular weight of 374.34 g/mol. Its IUPAC name is ethyl 4-[(2,4-difluorophenyl)methyl]piperazine-1-carboxylate;oxalic acid.
| Compound Name | ethyl 4-[(2,4-difluorophenyl)methyl]piperazine-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 2846018 |
| Molecular Formula | C16H20F2N2O6 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethyl 4-[(2,4-difluorophenyl)methyl]piperazine-1-carboxylate;oxalic acid |
| SMILES | CCOC(=O)N1CCN(Cc2ccc(F)cc2F)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H18F2N2O2.C2H2O4/c1-2-20-14(19)18-7-5-17(6-8-18)10-11-3-4-12(15)9-13(11)16;3-1(4)2(5)6/h3-4,9H,2,5-8,10H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | QMTJEKLDLSGDFO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|