C21H23FN2O5 — CID 17365985
1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-phenylethanone;oxalic acid (PubChem CID 17365985) has the molecular formula C21H23FN2O5 and a molecular weight of 402.42 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-phenylethanone;oxalic acid.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-phenylethanone;oxalic acid |
|---|---|
| PubChem CID | 17365985 |
| Molecular Formula | C21H23FN2O5 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl]piperazin-1-yl]-2-phenylethanone;oxalic acid |
| SMILES | O=C(Cc1ccccc1)N1CCN(Cc2ccc(F)cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H21FN2O.C2H2O4/c20-18-8-6-17(7-9-18)15-21-10-12-22(13-11-21)19(23)14-16-4-2-1-3-5-16;3-1(4)2(5)6/h1-9H,10-15H2;(H,3,4)(H,5,6) |
| InChIKey | CIHVMCROHPUAKS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|