C22H25F3N2O4 — CID 11948901
1-[(2-methylphenyl)methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid (PubChem CID 11948901) has the molecular formula C22H25F3N2O4 and a molecular weight of 438.45 g/mol. Its IUPAC name is 1-[(2-methylphenyl)methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid.
| Compound Name | 1-[(2-methylphenyl)methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 11948901 |
| Molecular Formula | C22H25F3N2O4 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-[(2-methylphenyl)methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]piperazine;oxalic acid |
| SMILES | Cc1ccccc1CN1CCN(Cc2ccccc2C(F)(F)F)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23F3N2.C2H2O4/c1-16-6-2-3-7-17(16)14-24-10-12-25(13-11-24)15-18-8-4-5-9-19(18)20(21,22)23;3-1(4)2(5)6/h2-9H,10-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | FJTUYHGOJDFPAB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|