C24H30N2O4 — CID 23724167
oxalic acid;1-[(E)-3-phenylprop-2-enyl]-4-(2-phenylpropyl)piperazine (PubChem CID 23724167) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is oxalic acid;1-[(E)-3-phenylprop-2-enyl]-4-(2-phenylpropyl)piperazine.
| Compound Name | oxalic acid;1-[(E)-3-phenylprop-2-enyl]-4-(2-phenylpropyl)piperazine |
|---|---|
| PubChem CID | 23724167 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | oxalic acid;1-[(E)-3-phenylprop-2-enyl]-4-(2-phenylpropyl)piperazine |
| SMILES | CC(CN1CCN(C/C=C/c2ccccc2)CC1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H28N2.C2H2O4/c1-20(22-12-6-3-7-13-22)19-24-17-15-23(16-18-24)14-8-11-21-9-4-2-5-10-21;3-1(4)2(5)6/h2-13,20H,14-19H2,1H3;(H,3,4)(H,5,6)/b11-8+; |
| InChIKey | UWLNIVBWLWLOEP-YGCVIUNWSA-N |
| XLogP | 3.28 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|