C17H18FNO4 — CID 654983
N-[(2-fluorophenyl)methyl]-N-methyl-1-phenylmethanamine;oxalic acid (PubChem CID 654983) has the molecular formula C17H18FNO4 and a molecular weight of 319.33 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N-methyl-1-phenylmethanamine;oxalic acid.
| Compound Name | N-[(2-fluorophenyl)methyl]-N-methyl-1-phenylmethanamine;oxalic acid |
|---|---|
| PubChem CID | 654983 |
| Molecular Formula | C17H18FNO4 |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N-methyl-1-phenylmethanamine;oxalic acid |
| SMILES | CN(Cc1ccccc1)Cc1ccccc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H16FN.C2H2O4/c1-17(11-13-7-3-2-4-8-13)12-14-9-5-6-10-15(14)16;3-1(4)2(5)6/h2-10H,11-12H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PMDNOTINRWYVHZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|