C17H23NO4 — CID 23724275
2-cyclohexyl-3,4-dihydro-1H-isoquinoline;oxalic acid (PubChem CID 23724275) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-cyclohexyl-3,4-dihydro-1H-isoquinoline;oxalic acid.
| Compound Name | 2-cyclohexyl-3,4-dihydro-1H-isoquinoline;oxalic acid |
|---|---|
| PubChem CID | 23724275 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-cyclohexyl-3,4-dihydro-1H-isoquinoline;oxalic acid |
| SMILES | O=C(O)C(=O)O.c1ccc2c(c1)CCN(C1CCCCC1)C2 |
| InChI | InChI=1S/C15H21N.C2H2O4/c1-2-8-15(9-3-1)16-11-10-13-6-4-5-7-14(13)12-16;3-1(4)2(5)6/h4-7,15H,1-3,8-12H2;(H,3,4)(H,5,6) |
| InChIKey | ABUUHULWYYINSL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|