C25H36N2O5 — CID 11948730
2-(dicyclohexylamino)-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone;oxalic acid (PubChem CID 11948730) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is 2-(dicyclohexylamino)-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone;oxalic acid.
| Compound Name | 2-(dicyclohexylamino)-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone;oxalic acid |
|---|---|
| PubChem CID | 11948730 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-(dicyclohexylamino)-1-(3,4-dihydro-1H-isoquinolin-2-yl)ethanone;oxalic acid |
| SMILES | O=C(CN(C1CCCCC1)C1CCCCC1)N1CCc2ccccc2C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H34N2O.C2H2O4/c26-23(24-16-15-19-9-7-8-10-20(19)17-24)18-25(21-11-3-1-4-12-21)22-13-5-2-6-14-22;3-1(4)2(5)6/h7-10,21-22H,1-6,11-18H2;(H,3,4)(H,5,6) |
| InChIKey | DSNGHXIQBDBTPE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|