C16H17F3O3 — CID 58309152
[4-(3,4,5-trifluorophenyl)cyclohexyl]oxymethyl prop-2-enoate (PubChem CID 58309152) has the molecular formula C16H17F3O3 and a molecular weight of 314.30 g/mol. Its IUPAC name is [4-(3,4,5-trifluorophenyl)cyclohexyl]oxymethyl prop-2-enoate.
| Compound Name | [4-(3,4,5-trifluorophenyl)cyclohexyl]oxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 58309152 |
| Molecular Formula | C16H17F3O3 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | [4-(3,4,5-trifluorophenyl)cyclohexyl]oxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOC1CCC(c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C16H17F3O3/c1-2-15(20)22-9-21-12-5-3-10(4-6-12)11-7-13(17)16(19)14(18)8-11/h2,7-8,10,12H,1,3-6,9H2 |
| InChIKey | HJQRICPKMANXTO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|