C11H18O4 — CID 146620066
(4-methoxycyclohexyl)oxymethyl prop-2-enoate (PubChem CID 146620066) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (4-methoxycyclohexyl)oxymethyl prop-2-enoate.
| Compound Name | (4-methoxycyclohexyl)oxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 146620066 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (4-methoxycyclohexyl)oxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOC1CCC(OC)CC1 |
| InChI | InChI=1S/C11H18O4/c1-3-11(12)15-8-14-10-6-4-9(13-2)5-7-10/h3,9-10H,1,4-8H2,2H3 |
| InChIKey | MUUFHWSAFZNIOR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|