C24H29F3O4 — CID 59360274
[2-oxo-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]oxyethyl] 2-methylprop-2-enoate (PubChem CID 59360274) has the molecular formula C24H29F3O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is [2-oxo-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]oxyethyl] 2-methylprop-2-enoate.
| Compound Name | [2-oxo-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]oxyethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59360274 |
| Molecular Formula | C24H29F3O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [2-oxo-2-[4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexyl]oxyethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H29F3O4/c1-14(2)24(29)30-13-22(28)31-19-9-7-16(8-10-19)15-3-5-17(6-4-15)18-11-20(25)23(27)21(26)12-18/h11-12,15-17,19H,1,3-10,13H2,2H3 |
| InChIKey | IEUSPMCAAXULGC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|