C18H24F3N — CID 152934815
4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexan-1-amine (PubChem CID 152934815) has the molecular formula C18H24F3N and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexan-1-amine.
| Compound Name | 4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 152934815 |
| Molecular Formula | C18H24F3N |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 4-[4-(3,4,5-trifluorophenyl)cyclohexyl]cyclohexan-1-amine |
| SMILES | NC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C18H24F3N/c19-16-9-14(10-17(20)18(16)21)13-3-1-11(2-4-13)12-5-7-15(22)8-6-12/h9-13,15H,1-8,22H2 |
| InChIKey | ULQVQNCWLKCUIP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|