C36H48ClF3 — CID 144554072
1-chloro-4-(4-cyclohexylcyclohexyl)benzene;5-(4-cyclohexylcyclohexyl)-1,2,3-trifluorobenzene (PubChem CID 144554072) has the molecular formula C36H48ClF3 and a molecular weight of 573.23 g/mol. Its IUPAC name is 1-chloro-4-(4-cyclohexylcyclohexyl)benzene;5-(4-cyclohexylcyclohexyl)-1,2,3-trifluorobenzene.
| Compound Name | 1-chloro-4-(4-cyclohexylcyclohexyl)benzene;5-(4-cyclohexylcyclohexyl)-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 144554072 |
| Molecular Formula | C36H48ClF3 |
| Molecular Weight | 573.23 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | 1-chloro-4-(4-cyclohexylcyclohexyl)benzene;5-(4-cyclohexylcyclohexyl)-1,2,3-trifluorobenzene |
| SMILES | Clc1ccc(C2CCC(C3CCCCC3)CC2)cc1.Fc1cc(C2CCC(C3CCCCC3)CC2)cc(F)c1F |
| InChI | InChI=1S/C18H25Cl.C18H23F3/c19-18-12-10-17(11-13-18)16-8-6-15(7-9-16)14-4-2-1-3-5-14;19-16-10-15(11-17(20)18(16)21)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h10-16H,1-9H2;10-14H,1-9H2 |
| InChIKey | FTECXAZHLFMQTH-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.23 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|