C30H33F7O — CID 118283125
5-[4-(4-cyclopentylcyclohexyl)cyclohexyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene (PubChem CID 118283125) has the molecular formula C30H33F7O and a molecular weight of 542.58 g/mol. Its IUPAC name is 5-[4-(4-cyclopentylcyclohexyl)cyclohexyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene.
| Compound Name | 5-[4-(4-cyclopentylcyclohexyl)cyclohexyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 118283125 |
| Molecular Formula | C30H33F7O |
| Molecular Weight | 542.58 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 5-[4-(4-cyclopentylcyclohexyl)cyclohexyl]-2-[difluoro-(3,4,5-trifluorophenoxy)methyl]-1,3-difluorobenzene |
| SMILES | Fc1cc(OC(F)(F)c2c(F)cc(C3CCC(C4CCC(C5CCCC5)CC4)CC3)cc2F)cc(F)c1F |
| InChI | InChI=1S/C30H33F7O/c31-24-13-22(14-25(32)28(24)30(36,37)38-23-15-26(33)29(35)27(34)16-23)21-11-9-20(10-12-21)19-7-5-18(6-8-19)17-3-1-2-4-17/h13-21H,1-12H2 |
| InChIKey | HXSPQGHAGSZWBJ-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.58 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|