C18H13F7O3 — CID 59207573
6-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]oxan-2-ol (PubChem CID 59207573) has the molecular formula C18H13F7O3 and a molecular weight of 410.29 g/mol. Its IUPAC name is 6-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]oxan-2-ol.
| Compound Name | 6-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]oxan-2-ol |
|---|---|
| PubChem CID | 59207573 |
| Molecular Formula | C18H13F7O3 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 6-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]oxan-2-ol |
| SMILES | OC1CCCC(c2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)O1 |
| InChI | InChI=1S/C18H13F7O3/c19-10-4-8(14-2-1-3-15(26)27-14)5-11(20)16(10)18(24,25)28-9-6-12(21)17(23)13(22)7-9/h4-7,14-15,26H,1-3H2 |
| InChIKey | XGNFBJTZVHSHJY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|