C25H25F7O4 — CID 59207574
2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-(5-propyloxan-2-yl)-1,3-dioxane (PubChem CID 59207574) has the molecular formula C25H25F7O4 and a molecular weight of 522.46 g/mol. Its IUPAC name is 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-(5-propyloxan-2-yl)-1,3-dioxane.
| Compound Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-(5-propyloxan-2-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 59207574 |
| Molecular Formula | C25H25F7O4 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-5-(5-propyloxan-2-yl)-1,3-dioxane |
| SMILES | CCCC1CCC(C2COC(c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)OC2)OC1 |
| InChI | InChI=1S/C25H25F7O4/c1-2-3-13-4-5-21(33-10-13)15-11-34-24(35-12-15)14-6-17(26)22(18(27)7-14)25(31,32)36-16-8-19(28)23(30)20(29)9-16/h6-9,13,15,21,24H,2-5,10-12H2,1H3 |
| InChIKey | QLUGYATVBNHPDL-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|