C29H33F7O2 — CID 118592700
2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]cyclohexyl]-5-propyloxane (PubChem CID 118592700) has the molecular formula C29H33F7O2 and a molecular weight of 546.57 g/mol. Its IUPAC name is 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]cyclohexyl]-5-propyloxane.
| Compound Name | 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]cyclohexyl]-5-propyloxane |
|---|---|
| PubChem CID | 118592700 |
| Molecular Formula | C29H33F7O2 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]cyclohexyl]-5-propyloxane |
| SMILES | CCCC1CCC(C2CCC(CCc3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3F)CC2)OC1 |
| InChI | InChI=1S/C29H33F7O2/c1-2-3-18-7-13-25(37-16-18)19-8-4-17(5-9-19)6-10-20-11-12-22(27(33)26(20)32)29(35,36)38-21-14-23(30)28(34)24(31)15-21/h11-12,14-15,17-19,25H,2-10,13,16H2,1H3 |
| InChIKey | OVVWLOKQWOCWQJ-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|