C27H23F7O2 — CID 129159532
2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]phenyl]-5-methyloxane (PubChem CID 129159532) has the molecular formula C27H23F7O2 and a molecular weight of 512.47 g/mol. Its IUPAC name is 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]phenyl]-5-methyloxane.
| Compound Name | 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]phenyl]-5-methyloxane |
|---|---|
| PubChem CID | 129159532 |
| Molecular Formula | C27H23F7O2 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2-[4-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-2,3-difluorophenyl]ethyl]phenyl]-5-methyloxane |
| SMILES | CC1CCC(c2ccc(CCc3ccc(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3F)cc2)OC1 |
| InChI | InChI=1S/C27H23F7O2/c1-15-2-11-23(35-14-15)17-6-3-16(4-7-17)5-8-18-9-10-20(25(31)24(18)30)27(33,34)36-19-12-21(28)26(32)22(29)13-19/h3-4,6-7,9-10,12-13,15,23H,2,5,8,11,14H2,1H3 |
| InChIKey | PIWQZLNNPFQATK-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|