C25H19F5N2O2S — CID 146335055
2-[6-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-pyridinyl]-6-(5-methyloxan-2-yl)-1,3-benzothiazole (PubChem CID 146335055) has the molecular formula C25H19F5N2O2S and a molecular weight of 506.50 g/mol. Its IUPAC name is 2-[6-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-pyridinyl]-6-(5-methyloxan-2-yl)-1,3-benzothiazole.
| Compound Name | 2-[6-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-pyridinyl]-6-(5-methyloxan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335055 |
| Molecular Formula | C25H19F5N2O2S |
| Molecular Weight | 506.50 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-[6-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3-pyridinyl]-6-(5-methyloxan-2-yl)-1,3-benzothiazole |
| SMILES | CC1CCC(c2ccc3nc(-c4ccc(C(F)(F)Oc5cc(F)c(F)c(F)c5)nc4)sc3c2)OC1 |
| InChI | InChI=1S/C25H19F5N2O2S/c1-13-2-6-20(33-12-13)14-3-5-19-21(8-14)35-24(32-19)15-4-7-22(31-11-15)25(29,30)34-16-9-17(26)23(28)18(27)10-16/h3-5,7-11,13,20H,2,6,12H2,1H3 |
| InChIKey | SSJMQYXLCQSFKQ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.50 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|