C30H18F9NO2S — CID 146335479
2-[2-[4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]ethynyl]-6-(5-ethenyloxan-2-yl)-1,3-benzothiazole (PubChem CID 146335479) has the molecular formula C30H18F9NO2S and a molecular weight of 627.53 g/mol. Its IUPAC name is 2-[2-[4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]ethynyl]-6-(5-ethenyloxan-2-yl)-1,3-benzothiazole.
| Compound Name | 2-[2-[4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]ethynyl]-6-(5-ethenyloxan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335479 |
| Molecular Formula | C30H18F9NO2S |
| Molecular Weight | 627.53 g/mol |
| Exact Mass | 627.09 |
| IUPAC Name | 2-[2-[4-[[3,5-difluoro-4-(trifluoromethyl)phenoxy]-difluoromethyl]-3,5-difluorophenyl]ethynyl]-6-(5-ethenyloxan-2-yl)-1,3-benzothiazole |
| SMILES | C=CC1CCC(c2ccc3nc(C#Cc4cc(F)c(C(F)(F)Oc5cc(F)c(C(F)(F)F)c(F)c5)c(F)c4)sc3c2)OC1 |
| InChI | InChI=1S/C30H18F9NO2S/c1-2-15-3-7-24(41-14-15)17-5-6-23-25(11-17)43-26(40-23)8-4-16-9-19(31)28(20(32)10-16)30(38,39)42-18-12-21(33)27(22(34)13-18)29(35,36)37/h2,5-6,9-13,15,24H,1,3,7,14H2 |
| InChIKey | YZKDNFAYZOCILI-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.53 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|