C25H17F7O3 — CID 122577270
2-[4-[difluoro-[4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-ethenyl-1,3-dioxane (PubChem CID 122577270) has the molecular formula C25H17F7O3 and a molecular weight of 498.39 g/mol. Its IUPAC name is 2-[4-[difluoro-[4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-ethenyl-1,3-dioxane.
| Compound Name | 2-[4-[difluoro-[4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-ethenyl-1,3-dioxane |
|---|---|
| PubChem CID | 122577270 |
| Molecular Formula | C25H17F7O3 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-[4-[difluoro-[4-(3,4,5-trifluorophenyl)phenoxy]methyl]-3,5-difluorophenyl]-5-ethenyl-1,3-dioxane |
| SMILES | C=CC1COC(c2cc(F)c(C(F)(F)Oc3ccc(-c4cc(F)c(F)c(F)c4)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C25H17F7O3/c1-2-13-11-33-24(34-12-13)16-9-18(26)22(19(27)10-16)25(31,32)35-17-5-3-14(4-6-17)15-7-20(28)23(30)21(29)8-15/h2-10,13,24H,1,11-12H2 |
| InChIKey | IFADQQFVHYIMFR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|