C28H22F7NO2S — CID 146335474
2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-7-ethyl-5-(5-methyloxan-2-yl)-1,3-thiazepine (PubChem CID 146335474) has the molecular formula C28H22F7NO2S and a molecular weight of 569.54 g/mol. Its IUPAC name is 2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-7-ethyl-5-(5-methyloxan-2-yl)-1,3-thiazepine.
| Compound Name | 2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-7-ethyl-5-(5-methyloxan-2-yl)-1,3-thiazepine |
|---|---|
| PubChem CID | 146335474 |
| Molecular Formula | C28H22F7NO2S |
| Molecular Weight | 569.54 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | 2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]ethynyl]-7-ethyl-5-(5-methyloxan-2-yl)-1,3-thiazepine |
| SMILES | CCC1=CC(C2CCC(C)CO2)=CN=C(C#Cc2cc(F)c(C(F)(F)Oc3cc(F)c(F)c(F)c3)c(F)c2)S1 |
| InChI | InChI=1S/C28H22F7NO2S/c1-3-19-10-17(24-6-4-15(2)14-37-24)13-36-25(39-19)7-5-16-8-20(29)26(21(30)9-16)28(34,35)38-18-11-22(31)27(33)23(32)12-18/h8-13,15,24H,3-4,6,14H2,1-2H3 |
| InChIKey | BVGGHCOLHLVHOG-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.54 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|