C48H53F7O2 — CID 144686981
1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene;2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane (PubChem CID 144686981) has the molecular formula C48H53F7O2 and a molecular weight of 794.94 g/mol. Its IUPAC name is 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene;2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane.
| Compound Name | 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene;2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane |
|---|---|
| PubChem CID | 144686981 |
| Molecular Formula | C48H53F7O2 |
| Molecular Weight | 794.94 g/mol |
| Exact Mass | 794.39 |
| IUPAC Name | 1-[4-(4-but-3-enylcyclohexyl)cyclohexyl]-4-methylbenzene;2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]-5-methyloxane |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(C)cc3)CC2)CC1.CC1CCC(c2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)cc2)OC1 |
| InChI | InChI=1S/C25H19F7O2.C23H34/c1-13-2-7-22(33-12-13)15-5-3-14(4-6-15)16-8-18(26)23(19(27)9-16)25(31,32)34-17-10-20(28)24(30)21(29)11-17;1-3-4-5-19-8-12-21(13-9-19)23-16-14-22(15-17-23)20-10-6-18(2)7-11-20/h3-6,8-11,13,22H,2,7,12H2,1H3;3,6-7,10-11,19,21-23H,1,4-5,8-9,12-17H2,2H3 |
| InChIKey | MGWVEDNQEXOOET-UHFFFAOYSA-N |
| XLogP | 14.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.94 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|