C22H14F5N3OS — CID 146335243
6-but-3-enyl-2-[2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidin-5-yl]-1,3-benzothiazole (PubChem CID 146335243) has the molecular formula C22H14F5N3OS and a molecular weight of 463.43 g/mol. Its IUPAC name is 6-but-3-enyl-2-[2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidin-5-yl]-1,3-benzothiazole.
| Compound Name | 6-but-3-enyl-2-[2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidin-5-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 146335243 |
| Molecular Formula | C22H14F5N3OS |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 6-but-3-enyl-2-[2-[difluoro-(3,4,5-trifluorophenoxy)methyl]pyrimidin-5-yl]-1,3-benzothiazole |
| SMILES | C=CCCc1ccc2nc(-c3cnc(C(F)(F)Oc4cc(F)c(F)c(F)c4)nc3)sc2c1 |
| InChI | InChI=1S/C22H14F5N3OS/c1-2-3-4-12-5-6-17-18(7-12)32-20(30-17)13-10-28-21(29-11-13)22(26,27)31-14-8-15(23)19(25)16(24)9-14/h2,5-11H,1,3-4H2 |
| InChIKey | JZOPLQSIPXCOEB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|