C25H21F11O2 — CID 170842709
2-[[3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene (PubChem CID 170842709) has the molecular formula C25H21F11O2 and a molecular weight of 562.42 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene.
| Compound Name | 2-[[3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene |
|---|---|
| PubChem CID | 170842709 |
| Molecular Formula | C25H21F11O2 |
| Molecular Weight | 562.42 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | 2-[[3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenoxy]-difluoromethyl]-1,3-difluoro-5-(4-propylcyclohexyl)benzene |
| SMILES | CCCC1CCC(c2cc(F)c(C(F)(F)Oc3cc(F)c(OC(F)=C(F)C(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H21F11O2/c1-2-3-12-4-6-13(7-5-12)14-8-16(26)20(17(27)9-14)25(35,36)38-15-10-18(28)21(19(29)11-15)37-23(31)22(30)24(32,33)34/h8-13H,2-7H2,1H3 |
| InChIKey | PQEAARZOTVHLAW-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.42 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|