C25H22F8O3 — CID 170842251
[3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate (PubChem CID 170842251) has the molecular formula C25H22F8O3 and a molecular weight of 522.43 g/mol. Its IUPAC name is [3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate.
| Compound Name | [3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 170842251 |
| Molecular Formula | C25H22F8O3 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | [3,5-difluoro-4-(1,2,3,3,3-pentafluoroprop-1-enoxy)phenyl] 2-fluoro-4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3cc(F)c(OC(F)=C(F)C(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C25H22F8O3/c1-2-3-13-4-6-14(7-5-13)15-8-9-17(18(26)10-15)24(34)35-16-11-19(27)21(20(28)12-16)36-23(30)22(29)25(31,32)33/h8-14H,2-7H2,1H3 |
| InChIKey | HDALWNVXILSUJV-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|