C24H31FO2 — CID 91162362
ethane;phenyl 2-fluoro-4-(4-propylcyclohexyl)benzoate (PubChem CID 91162362) has the molecular formula C24H31FO2 and a molecular weight of 370.51 g/mol. Its IUPAC name is ethane;phenyl 2-fluoro-4-(4-propylcyclohexyl)benzoate.
| Compound Name | ethane;phenyl 2-fluoro-4-(4-propylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 91162362 |
| Molecular Formula | C24H31FO2 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | ethane;phenyl 2-fluoro-4-(4-propylcyclohexyl)benzoate |
| SMILES | CC.CCCC1CCC(c2ccc(C(=O)Oc3ccccc3)c(F)c2)CC1 |
| InChI | InChI=1S/C22H25FO2.C2H6/c1-2-6-16-9-11-17(12-10-16)18-13-14-20(21(23)15-18)22(24)25-19-7-4-3-5-8-19;1-2/h3-5,7-8,13-17H,2,6,9-12H2,1H3;1-2H3 |
| InChIKey | AAZVOBOTJAXFFS-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|