C24H33F4I — CID 20654197
2-[difluoro(iodo)methyl]-1,3-difluoro-5-[4-[2-(4-propylcyclohexyl)ethyl]cyclohexyl]benzene (PubChem CID 20654197) has the molecular formula C24H33F4I and a molecular weight of 524.42 g/mol. Its IUPAC name is 2-[difluoro(iodo)methyl]-1,3-difluoro-5-[4-[2-(4-propylcyclohexyl)ethyl]cyclohexyl]benzene.
| Compound Name | 2-[difluoro(iodo)methyl]-1,3-difluoro-5-[4-[2-(4-propylcyclohexyl)ethyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 20654197 |
| Molecular Formula | C24H33F4I |
| Molecular Weight | 524.42 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-[difluoro(iodo)methyl]-1,3-difluoro-5-[4-[2-(4-propylcyclohexyl)ethyl]cyclohexyl]benzene |
| SMILES | CCCC1CCC(CCC2CCC(c3cc(F)c(C(F)(F)I)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H33F4I/c1-2-3-16-4-6-17(7-5-16)8-9-18-10-12-19(13-11-18)20-14-21(25)23(22(26)15-20)24(27,28)29/h14-19H,2-13H2,1H3 |
| InChIKey | LALQNIRWNALLOE-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.42 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|