C21H31F2N — CID 22731669
2,6-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]aniline (PubChem CID 22731669) has the molecular formula C21H31F2N and a molecular weight of 335.48 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]aniline.
| Compound Name | 2,6-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 22731669 |
| Molecular Formula | C21H31F2N |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 2,6-difluoro-4-[4-(4-propylcyclohexyl)cyclohexyl]aniline |
| SMILES | CCCC1CCC(C2CCC(c3cc(F)c(N)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C21H31F2N/c1-2-3-14-4-6-15(7-5-14)16-8-10-17(11-9-16)18-12-19(22)21(24)20(23)13-18/h12-17H,2-11,24H2,1H3 |
| InChIKey | AJZZFVIAPIWJTD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|