C18H23F3 — CID 67788915
5-[4-(3-ethylcyclobutyl)cyclohexyl]-1,2,3-trifluorobenzene (PubChem CID 67788915) has the molecular formula C18H23F3 and a molecular weight of 296.38 g/mol. Its IUPAC name is 5-[4-(3-ethylcyclobutyl)cyclohexyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-(3-ethylcyclobutyl)cyclohexyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 67788915 |
| Molecular Formula | C18H23F3 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 5-[4-(3-ethylcyclobutyl)cyclohexyl]-1,2,3-trifluorobenzene |
| SMILES | CCC1CC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)C1 |
| InChI | InChI=1S/C18H23F3/c1-2-11-7-14(8-11)12-3-5-13(6-4-12)15-9-16(19)18(21)17(20)10-15/h9-14H,2-8H2,1H3 |
| InChIKey | FVMJXRMSKVVRAF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|