C20H28F2O — CID 165344858
4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,6-difluorophenol (PubChem CID 165344858) has the molecular formula C20H28F2O and a molecular weight of 322.44 g/mol. Its IUPAC name is 4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,6-difluorophenol.
| Compound Name | 4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 165344858 |
| Molecular Formula | C20H28F2O |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-[4-(4-ethylcyclohexyl)cyclohexyl]-2,6-difluorophenol |
| SMILES | CCC1CCC(C2CCC(c3cc(F)c(O)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H28F2O/c1-2-13-3-5-14(6-4-13)15-7-9-16(10-8-15)17-11-18(21)20(23)19(22)12-17/h11-16,23H,2-10H2,1H3 |
| InChIKey | ZZZSPMPTDBKENQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |