C30H37F5O7 — CID 58609067
4-O-[4-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl] 1-O-[3-(2-methylprop-2-enoyloxy)propyl] butanedioate (PubChem CID 58609067) has the molecular formula C30H37F5O7 and a molecular weight of 604.61 g/mol. Its IUPAC name is 4-O-[4-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl] 1-O-[3-(2-methylprop-2-enoyloxy)propyl] butanedioate.
| Compound Name | 4-O-[4-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl] 1-O-[3-(2-methylprop-2-enoyloxy)propyl] butanedioate |
|---|---|
| PubChem CID | 58609067 |
| Molecular Formula | C30H37F5O7 |
| Molecular Weight | 604.61 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 4-O-[4-[4-[3,5-difluoro-4-(trifluoromethoxy)phenyl]cyclohexyl]cyclohexyl] 1-O-[3-(2-methylprop-2-enoyloxy)propyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCCOC(=O)CCC(=O)OC1CCC(C2CCC(c3cc(F)c(OC(F)(F)F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C30H37F5O7/c1-18(2)29(38)40-15-3-14-39-26(36)12-13-27(37)41-23-10-8-20(9-11-23)19-4-6-21(7-5-19)22-16-24(31)28(25(32)17-22)42-30(33,34)35/h16-17,19-21,23H,1,3-15H2,2H3 |
| InChIKey | CALXXIYBZRWQKZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|