C18H26N2O2 — CID 163978994
[5-(3,5-diaminophenyl)cyclooctyl] 2-methylprop-2-enoate (PubChem CID 163978994) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [5-(3,5-diaminophenyl)cyclooctyl] 2-methylprop-2-enoate.
| Compound Name | [5-(3,5-diaminophenyl)cyclooctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163978994 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [5-(3,5-diaminophenyl)cyclooctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCC(c2cc(N)cc(N)c2)CCC1 |
| InChI | InChI=1S/C18H26N2O2/c1-12(2)18(21)22-17-7-3-5-13(6-4-8-17)14-9-15(19)11-16(20)10-14/h9-11,13,17H,1,3-8,19-20H2,2H3 |
| InChIKey | SWRWUGALBUNREZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|