C28H38O8 — CID 174502958
bis(cyclohexyl 2-methylprop-2-enoate);terephthalic acid (PubChem CID 174502958) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is bis(cyclohexyl 2-methylprop-2-enoate);terephthalic acid.
| Compound Name | bis(cyclohexyl 2-methylprop-2-enoate);terephthalic acid |
|---|---|
| PubChem CID | 174502958 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | bis(cyclohexyl 2-methylprop-2-enoate);terephthalic acid |
| SMILES | C=C(C)C(=O)OC1CCCCC1.C=C(C)C(=O)OC1CCCCC1.O=C(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/2C10H16O2.C8H6O4/c2*1-8(2)10(11)12-9-6-4-3-5-7-9;9-7(10)5-1-2-6(4-3-5)8(11)12/h2*9H,1,3-7H2,2H3;1-4H,(H,9,10)(H,11,12) |
| InChIKey | MVRHLBXCGUFJJI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|