C26H36O6 — CID 70554494
benzyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 70554494) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is benzyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | benzyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70554494 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | benzyl 2-methylprop-2-enoate;cyclohexyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OC1CCCCC1.C=C(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C11H12O2.C10H16O2.C5H8O2/c1-9(2)11(12)13-8-10-6-4-3-5-7-10;1-8(2)10(11)12-9-6-4-3-5-7-9;1-4(2)5(6)7-3/h3-7H,1,8H2,2H3;9H,1,3-7H2,2H3;1H2,2-3H3 |
| InChIKey | NYCKAIZKNBPDBI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|